About 1-pentylbenzotriazole
1-pentylbenzotriazole (PubChem CID 3708772) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-pentylbenzotriazole.
Molecular Properties
| Compound Name | 1-pentylbenzotriazole |
| PubChem CID | 3708772 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-pentylbenzotriazole |
| SMILES | CCCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C11H15N3/c1-2-3-6-9-14-11-8-5-4-7-10(11)12-13-14/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | LQLGITWCPFIIHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylbenzotriazole?
The IUPAC name of 1-pentylbenzotriazole (CID 3708772) is 1-pentylbenzotriazole.
What is the SMILES notation for 1-pentylbenzotriazole?
The canonical SMILES for 1-pentylbenzotriazole is CCCCCn1nnc2ccccc21.
What is the InChIKey of 1-pentylbenzotriazole?
The InChIKey is LQLGITWCPFIIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-2-3-6-9-14-11-8-5-4-7-10(11)12-13-14/h4-5,7-8H,2-3,6,9H2,1H3.
What are the key properties of 1-pentylbenzotriazole?
1-pentylbenzotriazole has a molecular weight of 189.26 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylbenzotriazole is sourced from PubChem (CID 3708772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).