C19H16F3N5O2 — CID 37092246
[4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 37092246) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is [4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 37092246 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(C(=O)c2ccc3n[nH]nc3c2)CC1 |
| InChI | InChI=1S/C19H16F3N5O2/c20-19(21,22)14-4-1-12(2-5-14)17(28)26-7-9-27(10-8-26)18(29)13-3-6-15-16(11-13)24-25-23-15/h1-6,11H,7-10H2,(H,23,24,25) |
| InChIKey | YBHJUPFQKODQPR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |