C18H15NO2S2 — CID 3709903
10-methyl-12-oxa-4,8-dithia-6-azapentacyclo[11.8.0.02,10.03,7.016,21]henicosa-1(13),3(7),14,16,18,20-hexaen-5-one (PubChem CID 3709903) has the molecular formula C18H15NO2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 10-methyl-12-oxa-4,8-dithia-6-azapentacyclo[11.8.0.02,10.03,7.016,21]henicosa-1(13),3(7),14,16,18,20-hexaen-5-one.
| Compound Name | 10-methyl-12-oxa-4,8-dithia-6-azapentacyclo[11.8.0.02,10.03,7.016,21]henicosa-1(13),3(7),14,16,18,20-hexaen-5-one |
|---|---|
| PubChem CID | 3709903 |
| Molecular Formula | C18H15NO2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 10-methyl-12-oxa-4,8-dithia-6-azapentacyclo[11.8.0.02,10.03,7.016,21]henicosa-1(13),3(7),14,16,18,20-hexaen-5-one |
| SMILES | CC12COc3ccc4ccccc4c3C1c1sc(=O)[nH]c1SC2 |
| InChI | InChI=1S/C18H15NO2S2/c1-18-8-21-12-7-6-10-4-2-3-5-11(10)13(12)14(18)15-16(22-9-18)19-17(20)23-15/h2-7,14H,8-9H2,1H3,(H,19,20) |
| InChIKey | MVCHNDAEFUUZBT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|