C17H15N7O3 — CID 3710499
7-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 3710499) has the molecular formula C17H15N7O3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 7-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | 7-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 3710499 |
| Molecular Formula | C17H15N7O3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 7-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | CN(C)c1cc(N2CCn3c2nc2ccccc23)c2nonc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N7O3/c1-21(2)13-9-12(14-15(20-27-19-14)16(13)24(25)26)23-8-7-22-11-6-4-3-5-10(11)18-17(22)23/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | VMLHWRLXKTXKSN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|