C11H18N2O2S — CID 3711689
8-ethylsulfanyl-3,3-dimethyl-6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 3711689) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 8-ethylsulfanyl-3,3-dimethyl-6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 8-ethylsulfanyl-3,3-dimethyl-6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 3711689 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 8-ethylsulfanyl-3,3-dimethyl-6,7,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CCSC1CCN2C(=O)C(C)(C)NC(=O)C12 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-16-7-5-6-13-8(7)9(14)12-11(2,3)10(13)15/h7-8H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | ZIELFYCJCHJFHF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |