C23H34N4O2S — CID 3711690
N,N-diethyl-2-[5-hydroxy-2-(1H-imidazol-5-yl)-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide (PubChem CID 3711690) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is N,N-diethyl-2-[5-hydroxy-2-(1H-imidazol-5-yl)-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide.
| Compound Name | N,N-diethyl-2-[5-hydroxy-2-(1H-imidazol-5-yl)-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 3711690 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N,N-diethyl-2-[5-hydroxy-2-(1H-imidazol-5-yl)-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
| SMILES | CCN(CC)C(=O)C(C)C1CCC2(C)Cc3sc(-c4cnc[nH]4)nc3C(C)C2C1O |
| InChI | InChI=1S/C23H34N4O2S/c1-6-27(7-2)22(29)13(3)15-8-9-23(5)10-17-19(14(4)18(23)20(15)28)26-21(30-17)16-11-24-12-25-16/h11-15,18,20,28H,6-10H2,1-5H3,(H,24,25) |
| InChIKey | AIJKBIYMIAOLSR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |