C16H22Cl2N2O — CID 3711942
N-[(2,6-dichlorophenyl)methylideneamino]nonanamide (PubChem CID 3711942) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]nonanamide.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]nonanamide |
|---|---|
| PubChem CID | 3711942 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]nonanamide |
| SMILES | CCCCCCCCC(=O)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O/c1-2-3-4-5-6-7-11-16(21)20-19-12-13-14(17)9-8-10-15(13)18/h8-10,12H,2-7,11H2,1H3,(H,20,21) |
| InChIKey | KFJTZVIXYIQRFK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|