About 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide
2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide (PubChem CID 3712568) has the molecular formula C17H15N3O3S
and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide.
Molecular Properties
| Compound Name | 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide |
| PubChem CID | 3712568 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CCn1c(=S)oc2ccccc21 |
| InChI | InChI=1S/C17H15N3O3S/c18-16(22)11-5-1-2-6-12(11)19-15(21)9-10-20-13-7-3-4-8-14(13)23-17(20)24/h1-8H,9-10H2,(H2,18,22)(H,19,21) |
| InChIKey | BJXVCMICURONNZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide?
The IUPAC name of 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide (CID 3712568) is 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide.
What is the SMILES notation for 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide?
The canonical SMILES for 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide is NC(=O)c1ccccc1NC(=O)CCn1c(=S)oc2ccccc21.
What is the InChIKey of 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide?
The InChIKey is BJXVCMICURONNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3S/c18-16(22)11-5-1-2-6-12(11)19-15(21)9-10-20-13-7-3-4-8-14(13)23-17(20)24/h1-8H,9-10H2,(H2,18,22)(H,19,21).
What are the key properties of 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide?
2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide has a molecular weight of 341.39 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-sulfanylidene-1,3-benzoxazol-3-yl)propanoylamino]benzamide is sourced from PubChem (CID 3712568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).