About [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone
[4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone (PubChem CID 3712618) has the molecular formula C22H19BrN4OS
and a molecular weight of 467.39 g/mol. Its IUPAC name is [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone.
Molecular Properties
| Compound Name | [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone |
| PubChem CID | 3712618 |
| Molecular Formula | C22H19BrN4OS |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCC(c2nc(-c3cccc(Br)c3)cs2)CC1 |
| InChI | InChI=1S/C22H19BrN4OS/c23-16-5-3-4-15(12-16)19-13-29-21(24-19)14-8-10-27(11-9-14)22(28)20-17-6-1-2-7-18(17)25-26-20/h1-7,12-14H,8-11H2,(H,25,26) |
| InChIKey | MEMKMPKYNBCXMM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone?
The IUPAC name of [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone (CID 3712618) is [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone.
What is the SMILES notation for [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone?
The canonical SMILES for [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone is O=C(c1n[nH]c2ccccc12)N1CCC(c2nc(-c3cccc(Br)c3)cs2)CC1.
What is the InChIKey of [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone?
The InChIKey is MEMKMPKYNBCXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BrN4OS/c23-16-5-3-4-15(12-16)19-13-29-21(24-19)14-8-10-27(11-9-14)22(28)20-17-6-1-2-7-18(17)25-26-20/h1-7,12-14H,8-11H2,(H,25,26).
What are the key properties of [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone?
[4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone has a molecular weight of 467.39 g/mol, XLogP of 5.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3-bromophenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-(1H-indazol-3-yl)methanone is sourced from PubChem (CID 3712618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).