C24H20ClN3O4S2 — CID 3713000
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,4-dioxonaphthalen-2-yl]thiophene-2-sulfonamide (PubChem CID 3713000) has the molecular formula C24H20ClN3O4S2 and a molecular weight of 514.03 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,4-dioxonaphthalen-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,4-dioxonaphthalen-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3713000 |
| Molecular Formula | C24H20ClN3O4S2 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]-1,4-dioxonaphthalen-2-yl]thiophene-2-sulfonamide |
| SMILES | O=C1C(NS(=O)(=O)c2cccs2)=C(N2CCN(c3cccc(Cl)c3)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H20ClN3O4S2/c25-16-5-3-6-17(15-16)27-10-12-28(13-11-27)22-21(26-34(31,32)20-9-4-14-33-20)23(29)18-7-1-2-8-19(18)24(22)30/h1-9,14-15,26H,10-13H2 |
| InChIKey | HQNIQZQMKGFDMV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|