C19H15FN4O2S — CID 3713328
2-[(6-acetamido-3-pyridinyl)sulfanyl]-N-(4-fluorophenyl)pyridine-3-carboxamide (PubChem CID 3713328) has the molecular formula C19H15FN4O2S and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[(6-acetamido-3-pyridinyl)sulfanyl]-N-(4-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 2-[(6-acetamido-3-pyridinyl)sulfanyl]-N-(4-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3713328 |
| Molecular Formula | C19H15FN4O2S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[(6-acetamido-3-pyridinyl)sulfanyl]-N-(4-fluorophenyl)pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(Sc2ncccc2C(=O)Nc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C19H15FN4O2S/c1-12(25)23-17-9-8-15(11-22-17)27-19-16(3-2-10-21-19)18(26)24-14-6-4-13(20)5-7-14/h2-11H,1H3,(H,24,26)(H,22,23,25) |
| InChIKey | GZKSGGUOGSWEIA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |