About 3-octylsulfinylthiolane 1,1-dioxide
3-octylsulfinylthiolane 1,1-dioxide (PubChem CID 3713404) has the molecular formula C12H24O3S2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-octylsulfinylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-octylsulfinylthiolane 1,1-dioxide |
| PubChem CID | 3713404 |
| Molecular Formula | C12H24O3S2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-octylsulfinylthiolane 1,1-dioxide |
| SMILES | CCCCCCCCS(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24O3S2/c1-2-3-4-5-6-7-9-16(13)12-8-10-17(14,15)11-12/h12H,2-11H2,1H3 |
| InChIKey | LVQLIPAPFDQCOI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octylsulfinylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylsulfinylthiolane 1,1-dioxide?
The IUPAC name of 3-octylsulfinylthiolane 1,1-dioxide (CID 3713404) is 3-octylsulfinylthiolane 1,1-dioxide.
What is the SMILES notation for 3-octylsulfinylthiolane 1,1-dioxide?
The canonical SMILES for 3-octylsulfinylthiolane 1,1-dioxide is CCCCCCCCS(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 3-octylsulfinylthiolane 1,1-dioxide?
The InChIKey is LVQLIPAPFDQCOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S2/c1-2-3-4-5-6-7-9-16(13)12-8-10-17(14,15)11-12/h12H,2-11H2,1H3.
What are the key properties of 3-octylsulfinylthiolane 1,1-dioxide?
3-octylsulfinylthiolane 1,1-dioxide has a molecular weight of 280.45 g/mol, XLogP of 2.28, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylsulfinylthiolane 1,1-dioxide is sourced from PubChem (CID 3713404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).