About 3,8-dichlorobenzo[c][1,2]benzodithiine
3,8-dichlorobenzo[c][1,2]benzodithiine (PubChem CID 3713861) has the molecular formula C12H6Cl2S2
and a molecular weight of 285.22 g/mol. Its IUPAC name is 3,8-dichlorobenzo[c][1,2]benzodithiine.
Molecular Properties
| Compound Name | 3,8-dichlorobenzo[c][1,2]benzodithiine |
| PubChem CID | 3713861 |
| Molecular Formula | C12H6Cl2S2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 3,8-dichlorobenzo[c][1,2]benzodithiine |
| SMILES | Clc1ccc2c(c1)SSc1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C12H6Cl2S2/c13-7-1-3-9-10-4-2-8(14)6-12(10)16-15-11(9)5-7/h1-6H |
| InChIKey | YEPGUJQRTYXIQZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dichlorobenzo[c][1,2]benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dichlorobenzo[c][1,2]benzodithiine?
The IUPAC name of 3,8-dichlorobenzo[c][1,2]benzodithiine (CID 3713861) is 3,8-dichlorobenzo[c][1,2]benzodithiine.
What is the SMILES notation for 3,8-dichlorobenzo[c][1,2]benzodithiine?
The canonical SMILES for 3,8-dichlorobenzo[c][1,2]benzodithiine is Clc1ccc2c(c1)SSc1cc(Cl)ccc1-2.
What is the InChIKey of 3,8-dichlorobenzo[c][1,2]benzodithiine?
The InChIKey is YEPGUJQRTYXIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2S2/c13-7-1-3-9-10-4-2-8(14)6-12(10)16-15-11(9)5-7/h1-6H.
What are the key properties of 3,8-dichlorobenzo[c][1,2]benzodithiine?
3,8-dichlorobenzo[c][1,2]benzodithiine has a molecular weight of 285.22 g/mol, XLogP of 5.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dichlorobenzo[c][1,2]benzodithiine is sourced from PubChem (CID 3713861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).