About (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone
(5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone (PubChem CID 3714114) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone |
| PubChem CID | 3714114 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone |
| SMILES | CC1CC2(CCCC2)N(C(=O)N2CCOCC2)Cc2ccccc21 |
| InChI | InChI=1S/C20H28N2O2/c1-16-14-20(8-4-5-9-20)22(15-17-6-2-3-7-18(16)17)19(23)21-10-12-24-13-11-21/h2-3,6-7,16H,4-5,8-15H2,1H3 |
| InChIKey | NBARAQXTAHHYBB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone?
The IUPAC name of (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone (CID 3714114) is (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone is CC1CC2(CCCC2)N(C(=O)N2CCOCC2)Cc2ccccc21.
What is the InChIKey of (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone?
The InChIKey is NBARAQXTAHHYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O2/c1-16-14-20(8-4-5-9-20)22(15-17-6-2-3-7-18(16)17)19(23)21-10-12-24-13-11-21/h2-3,6-7,16H,4-5,8-15H2,1H3.
What are the key properties of (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone?
(5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone has a molecular weight of 328.46 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylspiro[4,5-dihydro-1H-2-benzazepine-3,1'-cyclopentane]-2-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 3714114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).