C26H27ClN4O7 — CID 3714218
3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3714218) has the molecular formula C26H27ClN4O7 and a molecular weight of 542.98 g/mol. Its IUPAC name is 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3714218 |
| Molecular Formula | C26H27ClN4O7 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 3-[3-(carbamoylamino)propyl]-5-(3-chloro-4-methylphenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)C3C(c4ccc5c(c4)OCCO5)NC(CCCNC(N)=O)(C(=O)O)C3C2=O)cc1Cl |
| InChI | InChI=1S/C26H27ClN4O7/c1-13-3-5-15(12-16(13)27)31-22(32)19-20(23(31)33)26(24(34)35,7-2-8-29-25(28)36)30-21(19)14-4-6-17-18(11-14)38-10-9-37-17/h3-6,11-12,19-21,30H,2,7-10H2,1H3,(H,34,35)(H3,28,29,36) |
| InChIKey | XPKOQVVGEONKPK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|