About [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (PubChem CID 3714234) has the molecular formula C7H14N2O5S
and a molecular weight of 238.26 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
Molecular Properties
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| PubChem CID | 3714234 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| SMILES | NC(=S)NC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14N2O5S/c8-7(15)9-6-5(13)4(12)3(11)2(1-10)14-6/h2-6,10-13H,1H2,(H3,8,9,15) |
| InChIKey | NFLXFOWCDDYFIR-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The IUPAC name of [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (CID 3714234) is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
What is the SMILES notation for [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The canonical SMILES for [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea is NC(=S)NC1OC(CO)C(O)C(O)C1O.
What is the InChIKey of [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
The InChIKey is NFLXFOWCDDYFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O5S/c8-7(15)9-6-5(13)4(12)3(11)2(1-10)14-6/h2-6,10-13H,1H2,(H3,8,9,15).
What are the key properties of [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea?
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea has a molecular weight of 238.26 g/mol, XLogP of -3.38, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea is sourced from PubChem (CID 3714234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).