About 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione
3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione (PubChem CID 37143760) has the molecular formula C18H15N3O2S2
and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione |
| PubChem CID | 37143760 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione |
| SMILES | Cc1nc(-c2ccc(CCn3c(=O)[nH]c4ccccc4c3=O)s2)cs1 |
| InChI | InChI=1S/C18H15N3O2S2/c1-11-19-15(10-24-11)16-7-6-12(25-16)8-9-21-17(22)13-4-2-3-5-14(13)20-18(21)23/h2-7,10H,8-9H2,1H3,(H,20,23) |
| InChIKey | LXTMZNCAAOLJIN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione?
The IUPAC name of 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione (CID 37143760) is 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione?
The canonical SMILES for 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione is Cc1nc(-c2ccc(CCn3c(=O)[nH]c4ccccc4c3=O)s2)cs1.
What is the InChIKey of 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione?
The InChIKey is LXTMZNCAAOLJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2S2/c1-11-19-15(10-24-11)16-7-6-12(25-16)8-9-21-17(22)13-4-2-3-5-14(13)20-18(21)23/h2-7,10H,8-9H2,1H3,(H,20,23).
What are the key properties of 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione?
3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione has a molecular weight of 369.47 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1H-quinazoline-2,4-dione is sourced from PubChem (CID 37143760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).