About 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine
3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 37145338) has the molecular formula C10H11BrN4O2S2
and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine |
| PubChem CID | 37145338 |
| Molecular Formula | C10H11BrN4O2S2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Nn1cnnc1SCCS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11BrN4O2S2/c11-8-1-3-9(4-2-8)19(16,17)6-5-18-10-14-13-7-15(10)12/h1-4,7H,5-6,12H2 |
| InChIKey | TZMNSRBNCLNWHS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine?
The IUPAC name of 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine (CID 37145338) is 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine?
The canonical SMILES for 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine is Nn1cnnc1SCCS(=O)(=O)c1ccc(Br)cc1.
What is the InChIKey of 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine?
The InChIKey is TZMNSRBNCLNWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN4O2S2/c11-8-1-3-9(4-2-8)19(16,17)6-5-18-10-14-13-7-15(10)12/h1-4,7H,5-6,12H2.
What are the key properties of 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine?
3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine has a molecular weight of 363.26 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-bromophenyl)sulfonylethylsulfanyl]-1,2,4-triazol-4-amine is sourced from PubChem (CID 37145338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).