About propan-2-yl N-(2-carbamoyloxyethyl)carbamate
propan-2-yl N-(2-carbamoyloxyethyl)carbamate (PubChem CID 3714875) has the molecular formula C7H14N2O4
and a molecular weight of 190.20 g/mol. Its IUPAC name is propan-2-yl N-(2-carbamoyloxyethyl)carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-(2-carbamoyloxyethyl)carbamate |
| PubChem CID | 3714875 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | propan-2-yl N-(2-carbamoyloxyethyl)carbamate |
| SMILES | CC(C)OC(=O)NCCOC(N)=O |
| InChI | InChI=1S/C7H14N2O4/c1-5(2)13-7(11)9-3-4-12-6(8)10/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11) |
| InChIKey | SICRHSHTSXDYFG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-(2-carbamoyloxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(2-carbamoyloxyethyl)carbamate?
The IUPAC name of propan-2-yl N-(2-carbamoyloxyethyl)carbamate (CID 3714875) is propan-2-yl N-(2-carbamoyloxyethyl)carbamate.
What is the SMILES notation for propan-2-yl N-(2-carbamoyloxyethyl)carbamate?
The canonical SMILES for propan-2-yl N-(2-carbamoyloxyethyl)carbamate is CC(C)OC(=O)NCCOC(N)=O.
What is the InChIKey of propan-2-yl N-(2-carbamoyloxyethyl)carbamate?
The InChIKey is SICRHSHTSXDYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O4/c1-5(2)13-7(11)9-3-4-12-6(8)10/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11).
What are the key properties of propan-2-yl N-(2-carbamoyloxyethyl)carbamate?
propan-2-yl N-(2-carbamoyloxyethyl)carbamate has a molecular weight of 190.20 g/mol, XLogP of 0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(2-carbamoyloxyethyl)carbamate is sourced from PubChem (CID 3714875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).