About 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide
5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide (PubChem CID 3715537) has the molecular formula C24H23N3O6
and a molecular weight of 449.46 g/mol. Its IUPAC name is 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide |
| PubChem CID | 3715537 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cc(C(=O)NCCOc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N3O6/c28-23(25-11-13-32-21-7-3-1-4-8-21)18-15-19(17-20(16-18)27(30)31)24(29)26-12-14-33-22-9-5-2-6-10-22/h1-10,15-17H,11-14H2,(H,25,28)(H,26,29) |
| InChIKey | MSICLLJJNBVACS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide?
The IUPAC name of 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide (CID 3715537) is 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide?
The canonical SMILES for 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide is O=C(NCCOc1ccccc1)c1cc(C(=O)NCCOc2ccccc2)cc([N+](=O)[O-])c1.
What is the InChIKey of 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide?
The InChIKey is MSICLLJJNBVACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O6/c28-23(25-11-13-32-21-7-3-1-4-8-21)18-15-19(17-20(16-18)27(30)31)24(29)26-12-14-33-22-9-5-2-6-10-22/h1-10,15-17H,11-14H2,(H,25,28)(H,26,29).
What are the key properties of 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide?
5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide has a molecular weight of 449.46 g/mol, XLogP of 3.21, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1-N,3-N-bis(2-phenoxyethyl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 3715537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).