C31H38N6O3S — CID 3715936
1,3-dimethyl-7-[2-oxo-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]purine-2,6-dione (PubChem CID 3715936) has the molecular formula C31H38N6O3S and a molecular weight of 574.75 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-oxo-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-oxo-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3715936 |
| Molecular Formula | C31H38N6O3S |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 1,3-dimethyl-7-[2-oxo-2-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N2CCC(c3nc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)cs3)CC2)n(C)c1=O |
| InChI | InChI=1S/C31H38N6O3S/c1-30(2)11-12-31(3,4)22-15-20(7-8-21(22)30)23-17-41-27(33-23)19-9-13-36(14-10-19)24(38)16-37-18-32-26-25(37)28(39)35(6)29(40)34(26)5/h7-8,15,17-19H,9-14,16H2,1-6H3 |
| InChIKey | NPJOQAKCNQANJX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |