About [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone
[2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone (PubChem CID 3716230) has the molecular formula C16H17N3O5S
and a molecular weight of 363.40 g/mol. Its IUPAC name is [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone.
Molecular Properties
| Compound Name | [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone |
| PubChem CID | 3716230 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCN2C(=O)c2ccccc2S(C)(=O)=O)no1 |
| InChI | InChI=1S/C16H17N3O5S/c1-11-10-13(17-24-11)16(21)19-9-5-8-18(19)15(20)12-6-3-4-7-14(12)25(2,22)23/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | KTLYOMSZJUJFFY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone?
The IUPAC name of [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone (CID 3716230) is [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone.
What is the SMILES notation for [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone?
The canonical SMILES for [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone is Cc1cc(C(=O)N2CCCN2C(=O)c2ccccc2S(C)(=O)=O)no1.
What is the InChIKey of [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone?
The InChIKey is KTLYOMSZJUJFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O5S/c1-11-10-13(17-24-11)16(21)19-9-5-8-18(19)15(20)12-6-3-4-7-14(12)25(2,22)23/h3-4,6-7,10H,5,8-9H2,1-2H3.
What are the key properties of [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone?
[2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone has a molecular weight of 363.40 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-methyl-1,2-oxazole-3-carbonyl)pyrazolidin-1-yl]-(2-methylsulfonylphenyl)methanone is sourced from PubChem (CID 3716230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).