C16H15N3O5 — CID 3716256
N-[2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3716256) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is N-[2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3716256 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(=NNC(=O)CNC(=O)c1ccc2c(c1)OCO2)c1ccco1 |
| InChI | InChI=1S/C16H15N3O5/c1-10(12-3-2-6-22-12)18-19-15(20)8-17-16(21)11-4-5-13-14(7-11)24-9-23-13/h2-7H,8-9H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | KRGUWCOUESYEEL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|