About 9-ethylcarbazole-3,6-dicarbaldehyde
9-ethylcarbazole-3,6-dicarbaldehyde (PubChem CID 3716675) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is 9-ethylcarbazole-3,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 9-ethylcarbazole-3,6-dicarbaldehyde |
| PubChem CID | 3716675 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 9-ethylcarbazole-3,6-dicarbaldehyde |
| SMILES | CCn1c2ccc(C=O)cc2c2cc(C=O)ccc21 |
| InChI | InChI=1S/C16H13NO2/c1-2-17-15-5-3-11(9-18)7-13(15)14-8-12(10-19)4-6-16(14)17/h3-10H,2H2,1H3 |
| InChIKey | YUYGLHDPWGWFQB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-ethylcarbazole-3,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylcarbazole-3,6-dicarbaldehyde?
The IUPAC name of 9-ethylcarbazole-3,6-dicarbaldehyde (CID 3716675) is 9-ethylcarbazole-3,6-dicarbaldehyde.
What is the SMILES notation for 9-ethylcarbazole-3,6-dicarbaldehyde?
The canonical SMILES for 9-ethylcarbazole-3,6-dicarbaldehyde is CCn1c2ccc(C=O)cc2c2cc(C=O)ccc21.
What is the InChIKey of 9-ethylcarbazole-3,6-dicarbaldehyde?
The InChIKey is YUYGLHDPWGWFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c1-2-17-15-5-3-11(9-18)7-13(15)14-8-12(10-19)4-6-16(14)17/h3-10H,2H2,1H3.
What are the key properties of 9-ethylcarbazole-3,6-dicarbaldehyde?
9-ethylcarbazole-3,6-dicarbaldehyde has a molecular weight of 251.29 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylcarbazole-3,6-dicarbaldehyde is sourced from PubChem (CID 3716675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).