About 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea
1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea (PubChem CID 3717067) has the molecular formula C14H20N2O2S2
and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea.
Molecular Properties
| Compound Name | 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea |
| PubChem CID | 3717067 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea |
| SMILES | CCN(C(=S)NC1(C)CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O2S2/c1-3-16(12-7-5-4-6-8-12)13(19)15-14(2)9-10-20(17,18)11-14/h4-8H,3,9-11H2,1-2H3,(H,15,19) |
| InChIKey | HUHKHWPEVSGTBU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea?
The IUPAC name of 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea (CID 3717067) is 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea.
What is the SMILES notation for 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea?
The canonical SMILES for 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea is CCN(C(=S)NC1(C)CCS(=O)(=O)C1)c1ccccc1.
What is the InChIKey of 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea?
The InChIKey is HUHKHWPEVSGTBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S2/c1-3-16(12-7-5-4-6-8-12)13(19)15-14(2)9-10-20(17,18)11-14/h4-8H,3,9-11H2,1-2H3,(H,15,19).
What are the key properties of 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea?
1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea has a molecular weight of 312.46 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(3-methyl-1,1-dioxothiolan-3-yl)-1-phenylthiourea is sourced from PubChem (CID 3717067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).