About 2-pyrazol-1-ylacetic acid
2-pyrazol-1-ylacetic acid (PubChem CID 3717462) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 2-pyrazol-1-ylacetic acid.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylacetic acid |
| PubChem CID | 3717462 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 2-pyrazol-1-ylacetic acid |
| SMILES | O=C(O)Cn1cccn1 |
| InChI | InChI=1S/C5H6N2O2/c8-5(9)4-7-3-1-2-6-7/h1-3H,4H2,(H,8,9) |
| InChIKey | LOSKNFQZTWYZHI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazol-1-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylacetic acid?
The IUPAC name of 2-pyrazol-1-ylacetic acid (CID 3717462) is 2-pyrazol-1-ylacetic acid.
What is the SMILES notation for 2-pyrazol-1-ylacetic acid?
The canonical SMILES for 2-pyrazol-1-ylacetic acid is O=C(O)Cn1cccn1.
What is the InChIKey of 2-pyrazol-1-ylacetic acid?
The InChIKey is LOSKNFQZTWYZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c8-5(9)4-7-3-1-2-6-7/h1-3H,4H2,(H,8,9).
What are the key properties of 2-pyrazol-1-ylacetic acid?
2-pyrazol-1-ylacetic acid has a molecular weight of 126.11 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylacetic acid is sourced from PubChem (CID 3717462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).