C12H7NO4 — CID 3718000
2,4-bis(furan-2-yl)-1,3-oxazin-6-one (PubChem CID 3718000) has the molecular formula C12H7NO4 and a molecular weight of 229.19 g/mol. Its IUPAC name is 2,4-bis(furan-2-yl)-1,3-oxazin-6-one.
| Compound Name | 2,4-bis(furan-2-yl)-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 3718000 |
| Molecular Formula | C12H7NO4 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2,4-bis(furan-2-yl)-1,3-oxazin-6-one |
| SMILES | O=c1cc(-c2ccco2)nc(-c2ccco2)o1 |
| InChI | InChI=1S/C12H7NO4/c14-11-7-8(9-3-1-5-15-9)13-12(17-11)10-4-2-6-16-10/h1-7H |
| InChIKey | PRXYUSHWJZSSNB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |