C13H15N3O3S — CID 3718178
2-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazin-6-ol (PubChem CID 3718178) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazin-6-ol.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazin-6-ol |
|---|---|
| PubChem CID | 3718178 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b][1,3]thiazin-6-ol |
| SMILES | COc1ccc(-c2nc3n(n2)CC(O)CS3)cc1OC |
| InChI | InChI=1S/C13H15N3O3S/c1-18-10-4-3-8(5-11(10)19-2)12-14-13-16(15-12)6-9(17)7-20-13/h3-5,9,17H,6-7H2,1-2H3 |
| InChIKey | OOPFBGREOKNQSK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |