C16H18NO+ — CID 3718535
15,15-dimethyl-15-azoniatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6,12-tetraen-8-one (PubChem CID 3718535) has the molecular formula C16H18NO+ and a molecular weight of 240.33 g/mol. Its IUPAC name is 15,15-dimethyl-15-azoniatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6,12-tetraen-8-one.
| Compound Name | 15,15-dimethyl-15-azoniatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6,12-tetraen-8-one |
|---|---|
| PubChem CID | 3718535 |
| Molecular Formula | C16H18NO+ |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 15,15-dimethyl-15-azoniatetracyclo[7.5.1.02,7.010,14]pentadeca-2,4,6,12-tetraen-8-one |
| SMILES | C[N+]1(C)C2C(=O)c3ccccc3C1C1C=CCC12 |
| InChI | InChI=1S/C16H18NO/c1-17(2)14-10-8-5-9-11(10)15(17)16(18)13-7-4-3-6-12(13)14/h3-8,10-11,14-15H,9H2,1-2H3/q+1 |
| InChIKey | ZQMPQGLAQPYWRW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|