C20H18N6O2 — CID 37185608
N-[(2-imidazol-1-yl-3-pyridinyl)methyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide (PubChem CID 37185608) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[(2-imidazol-1-yl-3-pyridinyl)methyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[(2-imidazol-1-yl-3-pyridinyl)methyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 37185608 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(2-imidazol-1-yl-3-pyridinyl)methyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCc2cccnc2-n2ccnc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H18N6O2/c1-14-16-6-2-3-7-17(16)20(28)26(24-14)12-18(27)23-11-15-5-4-8-22-19(15)25-10-9-21-13-25/h2-10,13H,11-12H2,1H3,(H,23,27) |
| InChIKey | UYVVFBLKAITALA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |