6-oxopyran-2,4-dicarboxylic acid

C7H4O6 — CID 372

IUPAC6-oxopyran-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)oc(=O)c1
InChIInChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12)
InChIKeyVRMXCPVFSJVVCA-UHFFFAOYSA-N
MW184.10 g/mol
LogP0.04
Rot. Bonds2

About 6-oxopyran-2,4-dicarboxylic acid

6-oxopyran-2,4-dicarboxylic acid (PubChem CID 372) has the molecular formula C7H4O6 and a molecular weight of 184.10 g/mol. Its IUPAC name is 6-oxopyran-2,4-dicarboxylic acid.

Molecular Properties

Compound Name6-oxopyran-2,4-dicarboxylic acid
PubChem CID372
Molecular FormulaC7H4O6
Molecular Weight184.10 g/mol
Exact Mass184.00
IUPAC Name6-oxopyran-2,4-dicarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)oc(=O)c1
InChIInChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12)
InChIKeyVRMXCPVFSJVVCA-UHFFFAOYSA-N
XLogP0.04
TPSA104.81 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.10
LogP ≤ 50.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-oxopyran-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-oxopyran-2,4-dicarboxylic acid?
The IUPAC name of 6-oxopyran-2,4-dicarboxylic acid (CID 372) is 6-oxopyran-2,4-dicarboxylic acid.
What is the SMILES notation for 6-oxopyran-2,4-dicarboxylic acid?
The canonical SMILES for 6-oxopyran-2,4-dicarboxylic acid is O=C(O)c1cc(C(=O)O)oc(=O)c1.
What is the InChIKey of 6-oxopyran-2,4-dicarboxylic acid?
The InChIKey is VRMXCPVFSJVVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12).
What are the key properties of 6-oxopyran-2,4-dicarboxylic acid?
6-oxopyran-2,4-dicarboxylic acid has a molecular weight of 184.10 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxopyran-2,4-dicarboxylic acid is sourced from PubChem (CID 372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).