About 6-oxopyran-2,4-dicarboxylic acid
6-oxopyran-2,4-dicarboxylic acid (PubChem CID 372) has the molecular formula C7H4O6
and a molecular weight of 184.10 g/mol. Its IUPAC name is 6-oxopyran-2,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 6-oxopyran-2,4-dicarboxylic acid |
| PubChem CID | 372 |
| Molecular Formula | C7H4O6 |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 6-oxopyran-2,4-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)oc(=O)c1 |
| InChI | InChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | VRMXCPVFSJVVCA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxopyran-2,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxopyran-2,4-dicarboxylic acid?
The IUPAC name of 6-oxopyran-2,4-dicarboxylic acid (CID 372) is 6-oxopyran-2,4-dicarboxylic acid.
What is the SMILES notation for 6-oxopyran-2,4-dicarboxylic acid?
The canonical SMILES for 6-oxopyran-2,4-dicarboxylic acid is O=C(O)c1cc(C(=O)O)oc(=O)c1.
What is the InChIKey of 6-oxopyran-2,4-dicarboxylic acid?
The InChIKey is VRMXCPVFSJVVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12).
What are the key properties of 6-oxopyran-2,4-dicarboxylic acid?
6-oxopyran-2,4-dicarboxylic acid has a molecular weight of 184.10 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxopyran-2,4-dicarboxylic acid is sourced from PubChem (CID 372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).