C18H12N4OS3 — CID 37201848
N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 37201848) has the molecular formula C18H12N4OS3 and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 37201848 |
| Molecular Formula | C18H12N4OS3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-(4-methyl-5-phenyl-1,3-thiazol-2-yl)-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cc3c(nc4sccn43)s2)sc1-c1ccccc1 |
| InChI | InChI=1S/C18H12N4OS3/c1-10-14(11-5-3-2-4-6-11)26-17(19-10)20-15(23)13-9-12-16(25-13)21-18-22(12)7-8-24-18/h2-9H,1H3,(H,19,20,23) |
| InChIKey | JFDTYLJAEUPSNM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |