sodium 4-methylbenzenesulfonate

C7H7NaO3S — CID 3720192

IUPACsodium 4-methylbenzenesulfonate
SMILESCc1ccc(S(=O)(=O)[O-])cc1.[Na+]
InChIInChI=1S/C7H8O3S.Na/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1
InChIKeyKVCGISUBCHHTDD-UHFFFAOYSA-M
MW194.19 g/mol
LogP-2.10
Rot. Bonds1

About sodium 4-methylbenzenesulfonate

sodium 4-methylbenzenesulfonate (PubChem CID 3720192) has the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. Its IUPAC name is sodium 4-methylbenzenesulfonate.

Molecular Properties

Compound Namesodium 4-methylbenzenesulfonate
PubChem CID3720192
Molecular FormulaC7H7NaO3S
Molecular Weight194.19 g/mol
Exact Mass194.00
IUPAC Namesodium 4-methylbenzenesulfonate
SMILESCc1ccc(S(=O)(=O)[O-])cc1.[Na+]
InChIInChI=1S/C7H8O3S.Na/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1
InChIKeyKVCGISUBCHHTDD-UHFFFAOYSA-M
XLogP-2.10
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 5-2.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 4-methylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-methylbenzenesulfonate?
The IUPAC name of sodium 4-methylbenzenesulfonate (CID 3720192) is sodium 4-methylbenzenesulfonate.
What is the SMILES notation for sodium 4-methylbenzenesulfonate?
The canonical SMILES for sodium 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-methylbenzenesulfonate?
The InChIKey is KVCGISUBCHHTDD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.Na/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium 4-methylbenzenesulfonate?
sodium 4-methylbenzenesulfonate has a molecular weight of 194.19 g/mol, XLogP of -2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-methylbenzenesulfonate is sourced from PubChem (CID 3720192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).