C23H24N4O3 — CID 37205010
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 37205010) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 37205010 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)C(=O)c1cc2c([nH]c1=O)CCCC2=O |
| InChI | InChI=1S/C23H24N4O3/c1-14-19(15(2)27(25-14)16-8-5-4-6-9-16)13-26(3)23(30)18-12-17-20(24-22(18)29)10-7-11-21(17)28/h4-6,8-9,12H,7,10-11,13H2,1-3H3,(H,24,29) |
| InChIKey | GBVXAHLMWWYCDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |