C25H26ClN3O4 — CID 3720581
(1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoate (PubChem CID 3720581) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoate.
| Compound Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoate |
|---|---|
| PubChem CID | 3720581 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (1-oxo-1-pyrrolidin-1-ylpropan-2-yl) 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoate |
| SMILES | CC(OC(=O)CCc1nc2cc(Cl)ccc2n(Cc2ccccc2)c1=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C25H26ClN3O4/c1-17(24(31)28-13-5-6-14-28)33-23(30)12-10-20-25(32)29(16-18-7-3-2-4-8-18)22-11-9-19(26)15-21(22)27-20/h2-4,7-9,11,15,17H,5-6,10,12-14,16H2,1H3 |
| InChIKey | OJZRRRBHDDKAAZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |