About methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate
methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 3720661) has the molecular formula C10H9ClN2O2S
and a molecular weight of 256.71 g/mol. Its IUPAC name is methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 3720661 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1sc2nc(C)nc(Cl)c2c1C |
| InChI | InChI=1S/C10H9ClN2O2S/c1-4-6-8(11)12-5(2)13-9(6)16-7(4)10(14)15-3/h1-3H3 |
| InChIKey | ZKRIVQOOENDMQL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (CID 3720661) is methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate is COC(=O)c1sc2nc(C)nc(Cl)c2c1C.
What is the InChIKey of methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is ZKRIVQOOENDMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O2S/c1-4-6-8(11)12-5(2)13-9(6)16-7(4)10(14)15-3/h1-3H3.
What are the key properties of methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate?
methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 256.71 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 3720661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).