About 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one
1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one (PubChem CID 3720904) has the molecular formula C25H22N2O2
and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one.
Molecular Properties
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one |
| PubChem CID | 3720904 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one |
| SMILES | Cc1ccc(CN2C(=O)C(O)(c3c[nH]c4ccccc34)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H22N2O2/c1-16-11-12-18(17(2)13-16)15-27-23-10-6-4-8-20(23)25(29,24(27)28)21-14-26-22-9-5-3-7-19(21)22/h3-14,26,29H,15H2,1-2H3 |
| InChIKey | RXUCURWJSKFVCH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one?
The IUPAC name of 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one (CID 3720904) is 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one.
What is the SMILES notation for 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one?
The canonical SMILES for 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one is Cc1ccc(CN2C(=O)C(O)(c3c[nH]c4ccccc34)c3ccccc32)c(C)c1.
What is the InChIKey of 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one?
The InChIKey is RXUCURWJSKFVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O2/c1-16-11-12-18(17(2)13-16)15-27-23-10-6-4-8-20(23)25(29,24(27)28)21-14-26-22-9-5-3-7-19(21)22/h3-14,26,29H,15H2,1-2H3.
What are the key properties of 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one?
1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one has a molecular weight of 382.46 g/mol, XLogP of 4.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylphenyl)methyl]-3-hydroxy-3-(1H-indol-3-yl)indol-2-one is sourced from PubChem (CID 3720904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).