C7H12N2O2S2 — CID 3721039
3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylthiourea (PubChem CID 3721039) has the molecular formula C7H12N2O2S2 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylthiourea.
| Compound Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 3721039 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N2O2S2/c1-9(2)7(12)8-6-3-4-13(10,11)5-6/h3-4,6H,5H2,1-2H3,(H,8,12) |
| InChIKey | ODAZISXKENWMIH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|