C15H12ClN3S — CID 3721323
3-(2-chloroethyl)-2-thiophen-2-ylimidazo[1,2-a]benzimidazole (PubChem CID 3721323) has the molecular formula C15H12ClN3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2-thiophen-2-ylimidazo[1,2-a]benzimidazole.
| Compound Name | 3-(2-chloroethyl)-2-thiophen-2-ylimidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 3721323 |
| Molecular Formula | C15H12ClN3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-(2-chloroethyl)-2-thiophen-2-ylimidazo[1,2-a]benzimidazole |
| SMILES | ClCCn1c(-c2cccs2)cn2c3ccccc3nc12 |
| InChI | InChI=1S/C15H12ClN3S/c16-7-8-18-13(14-6-3-9-20-14)10-19-12-5-2-1-4-11(12)17-15(18)19/h1-6,9-10H,7-8H2 |
| InChIKey | LTYBWMJVEXIRCZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|