About 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide
4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide (PubChem CID 37213722) has the molecular formula C22H28N2O2
and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide |
| PubChem CID | 37213722 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CN(C)Cc2c(C)cc(C)c(C(C)=O)c2C)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-14-11-15(2)21(17(4)25)16(3)20(14)13-24(6)12-18-7-9-19(10-8-18)22(26)23-5/h7-11H,12-13H2,1-6H3,(H,23,26) |
| InChIKey | BYIITFWRXCXBEC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide?
The IUPAC name of 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide (CID 37213722) is 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide.
What is the SMILES notation for 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide?
The canonical SMILES for 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide is CNC(=O)c1ccc(CN(C)Cc2c(C)cc(C)c(C(C)=O)c2C)cc1.
What is the InChIKey of 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide?
The InChIKey is BYIITFWRXCXBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O2/c1-14-11-15(2)21(17(4)25)16(3)20(14)13-24(6)12-18-7-9-19(10-8-18)22(26)23-5/h7-11H,12-13H2,1-6H3,(H,23,26).
What are the key properties of 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide?
4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide has a molecular weight of 352.48 g/mol, XLogP of 3.81, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3-acetyl-2,4,6-trimethylphenyl)methyl-methylamino]methyl]-N-methylbenzamide is sourced from PubChem (CID 37213722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).