About 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile
4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile (PubChem CID 3721414) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile |
| PubChem CID | 3721414 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile |
| SMILES | COc1ccccc1-c1c(C#N)c(C)nc(C)c1C#N |
| InChI | InChI=1S/C16H13N3O/c1-10-13(8-17)16(14(9-18)11(2)19-10)12-6-4-5-7-15(12)20-3/h4-7H,1-3H3 |
| InChIKey | VKYJJFNBPMZSEQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile?
The IUPAC name of 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile (CID 3721414) is 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile.
What is the SMILES notation for 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile?
The canonical SMILES for 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile is COc1ccccc1-c1c(C#N)c(C)nc(C)c1C#N.
What is the InChIKey of 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile?
The InChIKey is VKYJJFNBPMZSEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O/c1-10-13(8-17)16(14(9-18)11(2)19-10)12-6-4-5-7-15(12)20-3/h4-7H,1-3H3.
What are the key properties of 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile?
4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile has a molecular weight of 263.30 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarbonitrile is sourced from PubChem (CID 3721414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).