C22H36N2O3 — CID 3721769
8a-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 3721769) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is 8a-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | 8a-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 3721769 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 8a-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | CN1CCC(N(C)CC2C(=O)OC3CC4(C)CCCC5(CO5)C4CC32)CC1 |
| InChI | InChI=1S/C22H36N2O3/c1-21-7-4-8-22(14-26-22)19(21)11-16-17(20(25)27-18(16)12-21)13-24(3)15-5-9-23(2)10-6-15/h15-19H,4-14H2,1-3H3 |
| InChIKey | RJRSJNIBMBAAJD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|