C13H11NOS3 — CID 3721988
8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-15-thione (PubChem CID 3721988) has the molecular formula C13H11NOS3 and a molecular weight of 293.44 g/mol. Its IUPAC name is 8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-15-thione.
| Compound Name | 8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-15-thione |
|---|---|
| PubChem CID | 3721988 |
| Molecular Formula | C13H11NOS3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-15-thione |
| SMILES | S=c1[nH]c2c(s1)C1c3ccccc3OCC1CS2 |
| InChI | InChI=1S/C13H11NOS3/c16-13-14-12-11(18-13)10-7(6-17-12)5-15-9-4-2-1-3-8(9)10/h1-4,7,10H,5-6H2,(H,14,16) |
| InChIKey | CQEDRLWGEKTFRY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|