About N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide
N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 37219883) has the molecular formula C20H22ClFN2O4S
and a molecular weight of 440.92 g/mol. Its IUPAC name is N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide |
| PubChem CID | 37219883 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCN(Cc2cc(Cl)cc3c2OCOC3)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22ClFN2O4S/c21-16-9-14(20-15(10-16)12-27-13-28-20)11-24-7-5-18(6-8-24)23-29(25,26)19-3-1-17(22)2-4-19/h1-4,9-10,18,23H,5-8,11-13H2 |
| InChIKey | GLYXJRUMKSKDSK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide (CID 37219883) is N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide is O=S(=O)(NC1CCN(Cc2cc(Cl)cc3c2OCOC3)CC1)c1ccc(F)cc1.
What is the InChIKey of N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide?
The InChIKey is GLYXJRUMKSKDSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClFN2O4S/c21-16-9-14(20-15(10-16)12-27-13-28-20)11-24-7-5-18(6-8-24)23-29(25,26)19-3-1-17(22)2-4-19/h1-4,9-10,18,23H,5-8,11-13H2.
What are the key properties of N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide?
N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide has a molecular weight of 440.92 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]piperidin-4-yl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 37219883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).