About propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate
propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 3722053) has the molecular formula C12H17Br2NO4S3
and a molecular weight of 495.28 g/mol. Its IUPAC name is propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
| PubChem CID | 3722053 |
| Molecular Formula | C12H17Br2NO4S3 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 492.87 |
| IUPAC Name | propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1cc(Br)c(Br)s1)C(=O)OC(C)C |
| InChI | InChI=1S/C12H17Br2NO4S3/c1-7(2)19-12(16)9(4-5-20-3)15-22(17,18)10-6-8(13)11(14)21-10/h6-7,9,15H,4-5H2,1-3H3 |
| InChIKey | ZBWZOWCYPPOFTH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate?
The IUPAC name of propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate (CID 3722053) is propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate.
What is the SMILES notation for propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate?
The canonical SMILES for propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate is CSCCC(NS(=O)(=O)c1cc(Br)c(Br)s1)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate?
The InChIKey is ZBWZOWCYPPOFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br2NO4S3/c1-7(2)19-12(16)9(4-5-20-3)15-22(17,18)10-6-8(13)11(14)21-10/h6-7,9,15H,4-5H2,1-3H3.
What are the key properties of propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate?
propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate has a molecular weight of 495.28 g/mol, XLogP of 3.62, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate is sourced from PubChem (CID 3722053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).