About 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide
3,4-bis(butylsulfanyl)thiolane 1,1-dioxide (PubChem CID 3722210) has the molecular formula C12H24O2S3
and a molecular weight of 296.52 g/mol. Its IUPAC name is 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide |
| PubChem CID | 3722210 |
| Molecular Formula | C12H24O2S3 |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide |
| SMILES | CCCCSC1CS(=O)(=O)CC1SCCCC |
| InChI | InChI=1S/C12H24O2S3/c1-3-5-7-15-11-9-17(13,14)10-12(11)16-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | GJLPVBDHIRGTBK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide?
The IUPAC name of 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide (CID 3722210) is 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide.
What is the SMILES notation for 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide?
The canonical SMILES for 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide is CCCCSC1CS(=O)(=O)CC1SCCCC.
What is the InChIKey of 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide?
The InChIKey is GJLPVBDHIRGTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S3/c1-3-5-7-15-11-9-17(13,14)10-12(11)16-8-6-4-2/h11-12H,3-10H2,1-2H3.
What are the key properties of 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide?
3,4-bis(butylsulfanyl)thiolane 1,1-dioxide has a molecular weight of 296.52 g/mol, XLogP of 3.22, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(butylsulfanyl)thiolane 1,1-dioxide is sourced from PubChem (CID 3722210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).