C16H20N4O3 — CID 37225028
N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-methylimidazol-1-yl)acetamide (PubChem CID 37225028) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-methylimidazol-1-yl)acetamide.
| Compound Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-methylimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 37225028 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-methylimidazol-1-yl)acetamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)Cn2ccnc2C)c1 |
| InChI | InChI=1S/C16H20N4O3/c1-12-17-7-8-20(12)11-16(22)19(2)10-15(21)18-13-5-4-6-14(9-13)23-3/h4-9H,10-11H2,1-3H3,(H,18,21) |
| InChIKey | UVCFAAOZVOPLGI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |