About 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one
1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one (PubChem CID 3722655) has the molecular formula C18H26N2O3S2
and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one |
| PubChem CID | 3722655 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one |
| SMILES | CCCS(=O)(=O)N1CCC2(CCN(C(=O)C=Cc3ccsc3)CC2)C1 |
| InChI | InChI=1S/C18H26N2O3S2/c1-2-13-25(22,23)20-11-8-18(15-20)6-9-19(10-7-18)17(21)4-3-16-5-12-24-14-16/h3-5,12,14H,2,6-11,13,15H2,1H3 |
| InChIKey | ZECWKZAHXMHBMX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one?
The IUPAC name of 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one (CID 3722655) is 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one.
What is the SMILES notation for 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one?
The canonical SMILES for 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one is CCCS(=O)(=O)N1CCC2(CCN(C(=O)C=Cc3ccsc3)CC2)C1.
What is the InChIKey of 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one?
The InChIKey is ZECWKZAHXMHBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3S2/c1-2-13-25(22,23)20-11-8-18(15-20)6-9-19(10-7-18)17(21)4-3-16-5-12-24-14-16/h3-5,12,14H,2,6-11,13,15H2,1H3.
What are the key properties of 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one?
1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one has a molecular weight of 382.55 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-propylsulfonyl-2,8-diazaspiro[4.5]decan-8-yl)-3-thiophen-3-ylprop-2-en-1-one is sourced from PubChem (CID 3722655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).