C17H9Cl4NO5 — CID 3723449
3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid (PubChem CID 3723449) has the molecular formula C17H9Cl4NO5 and a molecular weight of 449.07 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid.
| Compound Name | 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 3723449 |
| Molecular Formula | C17H9Cl4NO5 |
| Molecular Weight | 449.07 g/mol |
| Exact Mass | 446.92 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C17H9Cl4NO5/c18-11-9-10(12(19)14(21)13(11)20)16(25)22(15(9)24)8(17(26)27)5-6-1-3-7(23)4-2-6/h1-4,8,23H,5H2,(H,26,27) |
| InChIKey | QVGMKKJNCQSGKT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|