About 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol
2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol (PubChem CID 3723609) has the molecular formula C15H12FN3O3
and a molecular weight of 301.28 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol.
Molecular Properties
| Compound Name | 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol |
| PubChem CID | 3723609 |
| Molecular Formula | C15H12FN3O3 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C2=NNC(c3ccccc3F)C2)c1 |
| InChI | InChI=1S/C15H12FN3O3/c16-12-4-2-1-3-10(12)13-8-14(18-17-13)11-7-9(19(21)22)5-6-15(11)20/h1-7,13,17,20H,8H2 |
| InChIKey | OKWVXVZNZAVFBE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol?
The IUPAC name of 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol (CID 3723609) is 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol.
What is the SMILES notation for 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol?
The canonical SMILES for 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol is O=[N+]([O-])c1ccc(O)c(C2=NNC(c3ccccc3F)C2)c1.
What is the InChIKey of 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol?
The InChIKey is OKWVXVZNZAVFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FN3O3/c16-12-4-2-1-3-10(12)13-8-14(18-17-13)11-7-9(19(21)22)5-6-15(11)20/h1-7,13,17,20H,8H2.
What are the key properties of 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol?
2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol has a molecular weight of 301.28 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenol is sourced from PubChem (CID 3723609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).